C19H28N4OS — CID 8693755
2-[4-(1,3-benzothiazol-2-ylmethyl)piperazin-1-yl]-N-pentylacetamide (PubChem CID 8693755) has the molecular formula C19H28N4OS and a molecular weight of 360.53 g/mol. Its IUPAC name is 2-[4-(1,3-benzothiazol-2-ylmethyl)piperazin-1-yl]-N-pentylacetamide.
| Compound Name | 2-[4-(1,3-benzothiazol-2-ylmethyl)piperazin-1-yl]-N-pentylacetamide |
|---|---|
| PubChem CID | 8693755 |
| Molecular Formula | C19H28N4OS |
| Molecular Weight | 360.53 g/mol |
| Exact Mass | 360.20 |
| IUPAC Name | 2-[4-(1,3-benzothiazol-2-ylmethyl)piperazin-1-yl]-N-pentylacetamide |
| SMILES | CCCCCNC(=O)CN1CCN(Cc2nc3ccccc3s2)CC1 |
| InChI | InChI=1S/C19H28N4OS/c1-2-3-6-9-20-18(24)14-22-10-12-23(13-11-22)15-19-21-16-7-4-5-8-17(16)25-19/h4-5,7-8H,2-3,6,9-15H2,1H3,(H,20,24) |
| InChIKey | VPDJZYMLJUVPMS-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 48.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.53 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|