C18H25N3OS — CID 31480507
2-[4-(1,3-benzothiazol-2-yl)piperidin-1-yl]-N-butylacetamide (PubChem CID 31480507) has the molecular formula C18H25N3OS and a molecular weight of 331.48 g/mol. Its IUPAC name is 2-[4-(1,3-benzothiazol-2-yl)piperidin-1-yl]-N-butylacetamide.
| Compound Name | 2-[4-(1,3-benzothiazol-2-yl)piperidin-1-yl]-N-butylacetamide |
|---|---|
| PubChem CID | 31480507 |
| Molecular Formula | C18H25N3OS |
| Molecular Weight | 331.48 g/mol |
| Exact Mass | 331.17 |
| IUPAC Name | 2-[4-(1,3-benzothiazol-2-yl)piperidin-1-yl]-N-butylacetamide |
| SMILES | CCCCNC(=O)CN1CCC(c2nc3ccccc3s2)CC1 |
| InChI | InChI=1S/C18H25N3OS/c1-2-3-10-19-17(22)13-21-11-8-14(9-12-21)18-20-15-6-4-5-7-16(15)23-18/h4-7,14H,2-3,8-13H2,1H3,(H,19,22) |
| InChIKey | OWNHXXAMFHSXHE-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.48 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|