C19H26N4O2S — CID 9136079
2-[(2R)-2-(1,3-benzothiazol-2-yl)piperidin-1-yl]-N-(butylcarbamoyl)acetamide (PubChem CID 9136079) has the molecular formula C19H26N4O2S and a molecular weight of 374.51 g/mol. Its IUPAC name is 2-[(2R)-2-(1,3-benzothiazol-2-yl)piperidin-1-yl]-N-(butylcarbamoyl)acetamide.
| Compound Name | 2-[(2R)-2-(1,3-benzothiazol-2-yl)piperidin-1-yl]-N-(butylcarbamoyl)acetamide |
|---|---|
| PubChem CID | 9136079 |
| Molecular Formula | C19H26N4O2S |
| Molecular Weight | 374.51 g/mol |
| Exact Mass | 374.18 |
| IUPAC Name | 2-[(2R)-2-(1,3-benzothiazol-2-yl)piperidin-1-yl]-N-(butylcarbamoyl)acetamide |
| SMILES | CCCCNC(=O)NC(=O)CN1CCCC[C@@H]1c1nc2ccccc2s1 |
| InChI | InChI=1S/C19H26N4O2S/c1-2-3-11-20-19(25)22-17(24)13-23-12-7-6-9-15(23)18-21-14-8-4-5-10-16(14)26-18/h4-5,8,10,15H,2-3,6-7,9,11-13H2,1H3,(H2,20,22,24,25)/t15-/m1/s1 |
| InChIKey | YAPJWYQUOKZFOG-OAHLLOKOSA-N |
| XLogP | 3.45 |
| TPSA | 74.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.51 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|