C17H22N2O2S — CID 78823435
butyl 2-[2-(1,3-benzothiazol-2-yl)pyrrolidin-1-yl]acetate (PubChem CID 78823435) has the molecular formula C17H22N2O2S and a molecular weight of 318.44 g/mol. Its IUPAC name is butyl 2-[2-(1,3-benzothiazol-2-yl)pyrrolidin-1-yl]acetate.
| Compound Name | butyl 2-[2-(1,3-benzothiazol-2-yl)pyrrolidin-1-yl]acetate |
|---|---|
| PubChem CID | 78823435 |
| Molecular Formula | C17H22N2O2S |
| Molecular Weight | 318.44 g/mol |
| Exact Mass | 318.14 |
| IUPAC Name | butyl 2-[2-(1,3-benzothiazol-2-yl)pyrrolidin-1-yl]acetate |
| SMILES | CCCCOC(=O)CN1CCCC1c1nc2ccccc2s1 |
| InChI | InChI=1S/C17H22N2O2S/c1-2-3-11-21-16(20)12-19-10-6-8-14(19)17-18-13-7-4-5-9-15(13)22-17/h4-5,7,9,14H,2-3,6,8,10-12H2,1H3 |
| InChIKey | VOZIGJQFTRILLV-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 42.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.44 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|