C15H20N2OS — CID 110931453
4-[2-(1,3-benzothiazol-2-yl)pyrrolidin-1-yl]butan-1-ol (PubChem CID 110931453) has the molecular formula C15H20N2OS and a molecular weight of 276.40 g/mol. Its IUPAC name is 4-[2-(1,3-benzothiazol-2-yl)pyrrolidin-1-yl]butan-1-ol.
| Compound Name | 4-[2-(1,3-benzothiazol-2-yl)pyrrolidin-1-yl]butan-1-ol |
|---|---|
| PubChem CID | 110931453 |
| Molecular Formula | C15H20N2OS |
| Molecular Weight | 276.40 g/mol |
| Exact Mass | 276.13 |
| IUPAC Name | 4-[2-(1,3-benzothiazol-2-yl)pyrrolidin-1-yl]butan-1-ol |
| SMILES | OCCCCN1CCCC1c1nc2ccccc2s1 |
| InChI | InChI=1S/C15H20N2OS/c18-11-4-3-9-17-10-5-7-13(17)15-16-12-6-1-2-8-14(12)19-15/h1-2,6,8,13,18H,3-5,7,9-11H2 |
| InChIKey | PNNNEPSUJRCOJF-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 36.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.40 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|