C16H20N2O2S — CID 95724560
butyl (2S)-2-(1,3-benzothiazol-2-yl)pyrrolidine-1-carboxylate (PubChem CID 95724560) has the molecular formula C16H20N2O2S and a molecular weight of 304.42 g/mol. Its IUPAC name is butyl (2S)-2-(1,3-benzothiazol-2-yl)pyrrolidine-1-carboxylate.
| Compound Name | butyl (2S)-2-(1,3-benzothiazol-2-yl)pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 95724560 |
| Molecular Formula | C16H20N2O2S |
| Molecular Weight | 304.42 g/mol |
| Exact Mass | 304.12 |
| IUPAC Name | butyl (2S)-2-(1,3-benzothiazol-2-yl)pyrrolidine-1-carboxylate |
| SMILES | CCCCOC(=O)N1CCC[C@H]1c1nc2ccccc2s1 |
| InChI | InChI=1S/C16H20N2O2S/c1-2-3-11-20-16(19)18-10-6-8-13(18)15-17-12-7-4-5-9-14(12)21-15/h4-5,7,9,13H,2-3,6,8,10-11H2,1H3/t13-/m0/s1 |
| InChIKey | KWGYSUVBNHUZDL-ZDUSSCGKSA-N |
| XLogP | 4.37 |
| TPSA | 42.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.42 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|