C18H25N3O2S — CID 94172156
(2S)-2-(1,3-benzothiazol-2-yl)-N-(4-methoxybutyl)piperidine-1-carboxamide (PubChem CID 94172156) has the molecular formula C18H25N3O2S and a molecular weight of 347.48 g/mol. Its IUPAC name is (2S)-2-(1,3-benzothiazol-2-yl)-N-(4-methoxybutyl)piperidine-1-carboxamide.
| Compound Name | (2S)-2-(1,3-benzothiazol-2-yl)-N-(4-methoxybutyl)piperidine-1-carboxamide |
|---|---|
| PubChem CID | 94172156 |
| Molecular Formula | C18H25N3O2S |
| Molecular Weight | 347.48 g/mol |
| Exact Mass | 347.17 |
| IUPAC Name | (2S)-2-(1,3-benzothiazol-2-yl)-N-(4-methoxybutyl)piperidine-1-carboxamide |
| SMILES | COCCCCNC(=O)N1CCCC[C@H]1c1nc2ccccc2s1 |
| InChI | InChI=1S/C18H25N3O2S/c1-23-13-7-5-11-19-18(22)21-12-6-4-9-15(21)17-20-14-8-2-3-10-16(14)24-17/h2-3,8,10,15H,4-7,9,11-13H2,1H3,(H,19,22)/t15-/m0/s1 |
| InChIKey | WSALSBNHNSTLEM-HNNXBMFYSA-N |
| XLogP | 3.96 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.48 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|