C16H23Cl2N3OS — CID 119829476
1-[2-(1,3-benzothiazol-2-yl)pyrrolidin-1-yl]-4-(methylamino)butan-1-one;dihydrochloride (PubChem CID 119829476) has the molecular formula C16H23Cl2N3OS and a molecular weight of 376.35 g/mol. Its IUPAC name is 1-[2-(1,3-benzothiazol-2-yl)pyrrolidin-1-yl]-4-(methylamino)butan-1-one;dihydrochloride.
| Compound Name | 1-[2-(1,3-benzothiazol-2-yl)pyrrolidin-1-yl]-4-(methylamino)butan-1-one;dihydrochloride |
|---|---|
| PubChem CID | 119829476 |
| Molecular Formula | C16H23Cl2N3OS |
| Molecular Weight | 376.35 g/mol |
| Exact Mass | 375.09 |
| IUPAC Name | 1-[2-(1,3-benzothiazol-2-yl)pyrrolidin-1-yl]-4-(methylamino)butan-1-one;dihydrochloride |
| SMILES | CNCCCC(=O)N1CCCC1c1nc2ccccc2s1.Cl.Cl |
| InChI | InChI=1S/C16H21N3OS.2ClH/c1-17-10-4-9-15(20)19-11-5-7-13(19)16-18-12-6-2-3-8-14(12)21-16;;/h2-3,6,8,13,17H,4-5,7,9-11H2,1H3;2*1H |
| InChIKey | WSUMBVKFSCBTRT-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.35 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|