C18H21N3O2S2 — CID 45353979
3-[3-[2-(1,3-benzothiazol-2-yl)piperidin-1-yl]-3-oxopropyl]-1,3-thiazolidin-2-one (PubChem CID 45353979) has the molecular formula C18H21N3O2S2 and a molecular weight of 375.52 g/mol. Its IUPAC name is 3-[3-[2-(1,3-benzothiazol-2-yl)piperidin-1-yl]-3-oxopropyl]-1,3-thiazolidin-2-one.
| Compound Name | 3-[3-[2-(1,3-benzothiazol-2-yl)piperidin-1-yl]-3-oxopropyl]-1,3-thiazolidin-2-one |
|---|---|
| PubChem CID | 45353979 |
| Molecular Formula | C18H21N3O2S2 |
| Molecular Weight | 375.52 g/mol |
| Exact Mass | 375.11 |
| IUPAC Name | 3-[3-[2-(1,3-benzothiazol-2-yl)piperidin-1-yl]-3-oxopropyl]-1,3-thiazolidin-2-one |
| SMILES | O=C1SCCN1CCC(=O)N1CCCCC1c1nc2ccccc2s1 |
| InChI | InChI=1S/C18H21N3O2S2/c22-16(8-10-20-11-12-24-18(20)23)21-9-4-3-6-14(21)17-19-13-5-1-2-7-15(13)25-17/h1-2,5,7,14H,3-4,6,8-12H2 |
| InChIKey | RQDBGCMDBJNJEH-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 53.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.52 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|