C20H27N3O2S2 — CID 8563060
methyl 6-[[(2R)-2-(1,3-benzothiazol-2-yl)piperidine-1-carbothioyl]amino]hexanoate (PubChem CID 8563060) has the molecular formula C20H27N3O2S2 and a molecular weight of 405.59 g/mol. Its IUPAC name is methyl 6-[[(2R)-2-(1,3-benzothiazol-2-yl)piperidine-1-carbothioyl]amino]hexanoate.
| Compound Name | methyl 6-[[(2R)-2-(1,3-benzothiazol-2-yl)piperidine-1-carbothioyl]amino]hexanoate |
|---|---|
| PubChem CID | 8563060 |
| Molecular Formula | C20H27N3O2S2 |
| Molecular Weight | 405.59 g/mol |
| Exact Mass | 405.15 |
| IUPAC Name | methyl 6-[[(2R)-2-(1,3-benzothiazol-2-yl)piperidine-1-carbothioyl]amino]hexanoate |
| SMILES | COC(=O)CCCCCNC(=S)N1CCCC[C@@H]1c1nc2ccccc2s1 |
| InChI | InChI=1S/C20H27N3O2S2/c1-25-18(24)12-3-2-7-13-21-20(26)23-14-8-6-10-16(23)19-22-15-9-4-5-11-17(15)27-19/h4-5,9,11,16H,2-3,6-8,10,12-14H2,1H3,(H,21,26)/t16-/m1/s1 |
| InChIKey | FQICBRVUMRCJGH-MRXNPFEDSA-N |
| XLogP | 4.43 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.59 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|