C19H19N3S2 — CID 8681588
(2S)-2-(1,3-benzothiazol-2-yl)-N-(2-methylphenyl)pyrrolidine-1-carbothioamide (PubChem CID 8681588) has the molecular formula C19H19N3S2 and a molecular weight of 353.52 g/mol. Its IUPAC name is (2S)-2-(1,3-benzothiazol-2-yl)-N-(2-methylphenyl)pyrrolidine-1-carbothioamide.
| Compound Name | (2S)-2-(1,3-benzothiazol-2-yl)-N-(2-methylphenyl)pyrrolidine-1-carbothioamide |
|---|---|
| PubChem CID | 8681588 |
| Molecular Formula | C19H19N3S2 |
| Molecular Weight | 353.52 g/mol |
| Exact Mass | 353.10 |
| IUPAC Name | (2S)-2-(1,3-benzothiazol-2-yl)-N-(2-methylphenyl)pyrrolidine-1-carbothioamide |
| SMILES | Cc1ccccc1NC(=S)N1CCC[C@H]1c1nc2ccccc2s1 |
| InChI | InChI=1S/C19H19N3S2/c1-13-7-2-3-8-14(13)21-19(23)22-12-6-10-16(22)18-20-15-9-4-5-11-17(15)24-18/h2-5,7-9,11,16H,6,10,12H2,1H3,(H,21,23)/t16-/m0/s1 |
| InChIKey | OXJNDMXJJUVUQE-INIZCTEOSA-N |
| XLogP | 5.14 |
| TPSA | 28.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.52 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|