C17H17N3S3 — CID 94744822
(2S)-2-(1,3-benzothiazol-2-yl)-N-(thiophen-2-ylmethyl)pyrrolidine-1-carbothioamide (PubChem CID 94744822) has the molecular formula C17H17N3S3 and a molecular weight of 359.55 g/mol. Its IUPAC name is (2S)-2-(1,3-benzothiazol-2-yl)-N-(thiophen-2-ylmethyl)pyrrolidine-1-carbothioamide.
| Compound Name | (2S)-2-(1,3-benzothiazol-2-yl)-N-(thiophen-2-ylmethyl)pyrrolidine-1-carbothioamide |
|---|---|
| PubChem CID | 94744822 |
| Molecular Formula | C17H17N3S3 |
| Molecular Weight | 359.55 g/mol |
| Exact Mass | 359.06 |
| IUPAC Name | (2S)-2-(1,3-benzothiazol-2-yl)-N-(thiophen-2-ylmethyl)pyrrolidine-1-carbothioamide |
| SMILES | S=C(NCc1cccs1)N1CCC[C@H]1c1nc2ccccc2s1 |
| InChI | InChI=1S/C17H17N3S3/c21-17(18-11-12-5-4-10-22-12)20-9-3-7-14(20)16-19-13-6-1-2-8-15(13)23-16/h1-2,4-6,8,10,14H,3,7,9,11H2,(H,18,21)/t14-/m0/s1 |
| InChIKey | WBIFVZIGFFBFMB-AWEZNQCLSA-N |
| XLogP | 4.57 |
| TPSA | 28.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.55 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|