C15H21N3O2S — CID 111119287
3-(1,3-benzothiazol-2-yl)-1-(2-hydroxyethyl)-1-pentylurea (PubChem CID 111119287) has the molecular formula C15H21N3O2S and a molecular weight of 307.42 g/mol. Its IUPAC name is 3-(1,3-benzothiazol-2-yl)-1-(2-hydroxyethyl)-1-pentylurea.
| Compound Name | 3-(1,3-benzothiazol-2-yl)-1-(2-hydroxyethyl)-1-pentylurea |
|---|---|
| PubChem CID | 111119287 |
| Molecular Formula | C15H21N3O2S |
| Molecular Weight | 307.42 g/mol |
| Exact Mass | 307.14 |
| IUPAC Name | 3-(1,3-benzothiazol-2-yl)-1-(2-hydroxyethyl)-1-pentylurea |
| SMILES | CCCCCN(CCO)C(=O)Nc1nc2ccccc2s1 |
| InChI | InChI=1S/C15H21N3O2S/c1-2-3-6-9-18(10-11-19)15(20)17-14-16-12-7-4-5-8-13(12)21-14/h4-5,7-8,19H,2-3,6,9-11H2,1H3,(H,16,17,20) |
| InChIKey | UWPNAHDNYQTGBX-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 65.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.42 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|