C17H24N2OS — CID 54184308
2-(1,3-benzothiazol-2-yl)-N,N-dibutylacetamide (PubChem CID 54184308) has the molecular formula C17H24N2OS and a molecular weight of 304.46 g/mol. Its IUPAC name is 2-(1,3-benzothiazol-2-yl)-N,N-dibutylacetamide.
| Compound Name | 2-(1,3-benzothiazol-2-yl)-N,N-dibutylacetamide |
|---|---|
| PubChem CID | 54184308 |
| Molecular Formula | C17H24N2OS |
| Molecular Weight | 304.46 g/mol |
| Exact Mass | 304.16 |
| IUPAC Name | 2-(1,3-benzothiazol-2-yl)-N,N-dibutylacetamide |
| SMILES | CCCCN(CCCC)C(=O)Cc1nc2ccccc2s1 |
| InChI | InChI=1S/C17H24N2OS/c1-3-5-11-19(12-6-4-2)17(20)13-16-18-14-9-7-8-10-15(14)21-16/h7-10H,3-6,11-13H2,1-2H3 |
| InChIKey | PEALOPQRECPFLI-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.46 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |