C18H24N2OS — CID 55598803
(E)-3-(1,3-benzothiazol-2-yl)-N,N-dibutylprop-2-enamide (PubChem CID 55598803) has the molecular formula C18H24N2OS and a molecular weight of 316.47 g/mol. Its IUPAC name is (E)-3-(1,3-benzothiazol-2-yl)-N,N-dibutylprop-2-enamide.
| Compound Name | (E)-3-(1,3-benzothiazol-2-yl)-N,N-dibutylprop-2-enamide |
|---|---|
| PubChem CID | 55598803 |
| Molecular Formula | C18H24N2OS |
| Molecular Weight | 316.47 g/mol |
| Exact Mass | 316.16 |
| IUPAC Name | (E)-3-(1,3-benzothiazol-2-yl)-N,N-dibutylprop-2-enamide |
| SMILES | CCCCN(CCCC)C(=O)/C=C/c1nc2ccccc2s1 |
| InChI | InChI=1S/C18H24N2OS/c1-3-5-13-20(14-6-4-2)18(21)12-11-17-19-15-9-7-8-10-16(15)22-17/h7-12H,3-6,13-14H2,1-2H3/b12-11+ |
| InChIKey | XKQPGIVQDGXBRI-VAWYXSNFSA-N |
| XLogP | 4.74 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.47 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|