C16H15N3OS2 — CID 103598762
3-(1,3-benzothiazol-2-yl)-N-methyl-N-[(2-methyl-1,3-thiazol-4-yl)methyl]prop-2-enamide (PubChem CID 103598762) has the molecular formula C16H15N3OS2 and a molecular weight of 329.45 g/mol. Its IUPAC name is 3-(1,3-benzothiazol-2-yl)-N-methyl-N-[(2-methyl-1,3-thiazol-4-yl)methyl]prop-2-enamide.
| Compound Name | 3-(1,3-benzothiazol-2-yl)-N-methyl-N-[(2-methyl-1,3-thiazol-4-yl)methyl]prop-2-enamide |
|---|---|
| PubChem CID | 103598762 |
| Molecular Formula | C16H15N3OS2 |
| Molecular Weight | 329.45 g/mol |
| Exact Mass | 329.07 |
| IUPAC Name | 3-(1,3-benzothiazol-2-yl)-N-methyl-N-[(2-methyl-1,3-thiazol-4-yl)methyl]prop-2-enamide |
| SMILES | Cc1nc(CN(C)C(=O)C=Cc2nc3ccccc3s2)cs1 |
| InChI | InChI=1S/C16H15N3OS2/c1-11-17-12(10-21-11)9-19(2)16(20)8-7-15-18-13-5-3-4-6-14(13)22-15/h3-8,10H,9H2,1-2H3 |
| InChIKey | URDUGMMAQCBPOK-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 46.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.45 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|