C21H21N3O2S — CID 9479461
(E)-3-(1,3-benzothiazol-2-yl)-N-[2-(2,5-dimethylanilino)-2-oxoethyl]-N-methylprop-2-enamide (PubChem CID 9479461) has the molecular formula C21H21N3O2S and a molecular weight of 379.49 g/mol. Its IUPAC name is (E)-3-(1,3-benzothiazol-2-yl)-N-[2-(2,5-dimethylanilino)-2-oxoethyl]-N-methylprop-2-enamide.
| Compound Name | (E)-3-(1,3-benzothiazol-2-yl)-N-[2-(2,5-dimethylanilino)-2-oxoethyl]-N-methylprop-2-enamide |
|---|---|
| PubChem CID | 9479461 |
| Molecular Formula | C21H21N3O2S |
| Molecular Weight | 379.49 g/mol |
| Exact Mass | 379.14 |
| IUPAC Name | (E)-3-(1,3-benzothiazol-2-yl)-N-[2-(2,5-dimethylanilino)-2-oxoethyl]-N-methylprop-2-enamide |
| SMILES | Cc1ccc(C)c(NC(=O)CN(C)C(=O)/C=C/c2nc3ccccc3s2)c1 |
| InChI | InChI=1S/C21H21N3O2S/c1-14-8-9-15(2)17(12-14)22-19(25)13-24(3)21(26)11-10-20-23-16-6-4-5-7-18(16)27-20/h4-12H,13H2,1-3H3,(H,22,25)/b11-10+ |
| InChIKey | KZUOUKLJWORVCZ-ZHACJKMWSA-N |
| XLogP | 4.02 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.49 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|