C20H22N2OS — CID 40710369
5-(1,3-benzothiazol-2-yl)-N-(2,5-dimethylphenyl)pentanamide (PubChem CID 40710369) has the molecular formula C20H22N2OS and a molecular weight of 338.48 g/mol. Its IUPAC name is 5-(1,3-benzothiazol-2-yl)-N-(2,5-dimethylphenyl)pentanamide.
| Compound Name | 5-(1,3-benzothiazol-2-yl)-N-(2,5-dimethylphenyl)pentanamide |
|---|---|
| PubChem CID | 40710369 |
| Molecular Formula | C20H22N2OS |
| Molecular Weight | 338.48 g/mol |
| Exact Mass | 338.15 |
| IUPAC Name | 5-(1,3-benzothiazol-2-yl)-N-(2,5-dimethylphenyl)pentanamide |
| SMILES | Cc1ccc(C)c(NC(=O)CCCCc2nc3ccccc3s2)c1 |
| InChI | InChI=1S/C20H22N2OS/c1-14-11-12-15(2)17(13-14)21-19(23)9-5-6-10-20-22-16-7-3-4-8-18(16)24-20/h3-4,7-8,11-13H,5-6,9-10H2,1-2H3,(H,21,23) |
| InChIKey | BUQPIRYWUJYXMO-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.48 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|