C21H22N2O4S — CID 119231471
2-[4-[5-(1,3-benzothiazol-2-yl)pentanoylamino]-3-methylphenoxy]acetic acid (PubChem CID 119231471) has the molecular formula C21H22N2O4S and a molecular weight of 398.48 g/mol. Its IUPAC name is 2-[4-[5-(1,3-benzothiazol-2-yl)pentanoylamino]-3-methylphenoxy]acetic acid.
| Compound Name | 2-[4-[5-(1,3-benzothiazol-2-yl)pentanoylamino]-3-methylphenoxy]acetic acid |
|---|---|
| PubChem CID | 119231471 |
| Molecular Formula | C21H22N2O4S |
| Molecular Weight | 398.48 g/mol |
| Exact Mass | 398.13 |
| IUPAC Name | 2-[4-[5-(1,3-benzothiazol-2-yl)pentanoylamino]-3-methylphenoxy]acetic acid |
| SMILES | Cc1cc(OCC(=O)O)ccc1NC(=O)CCCCc1nc2ccccc2s1 |
| InChI | InChI=1S/C21H22N2O4S/c1-14-12-15(27-13-21(25)26)10-11-16(14)22-19(24)8-4-5-9-20-23-17-6-2-3-7-18(17)28-20/h2-3,6-7,10-12H,4-5,8-9,13H2,1H3,(H,22,24)(H,25,26) |
| InChIKey | RKWJOAUBHSYTGE-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 88.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.48 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|