3-[5-(1,3-benzothiazol-2-yl)pentanoylamino]propanoic acid

C15H18N2O3S — CID 119177074

IUPAC3-[5-(1,3-benzothiazol-2-yl)pentanoylamino]propanoic acid
SMILESO=C(O)CCNC(=O)CCCCc1nc2ccccc2s1
InChIInChI=1S/C15H18N2O3S/c18-13(16-10-9-15(19)20)7-3-4-8-14-17-11-5-1-2-6-12(11)21-14/h1-2,5-6H,3-4,7-10H2,(H,16,18)(H,19,20)
InChIKeyPETJIQMQOLYERJ-UHFFFAOYSA-N
MW306.39 g/mol
LogP2.60
Rot. Bonds8

About 3-[5-(1,3-benzothiazol-2-yl)pentanoylamino]propanoic acid

3-[5-(1,3-benzothiazol-2-yl)pentanoylamino]propanoic acid (PubChem CID 119177074) has the molecular formula C15H18N2O3S and a molecular weight of 306.39 g/mol. Its IUPAC name is 3-[5-(1,3-benzothiazol-2-yl)pentanoylamino]propanoic acid.

Molecular Properties

Compound Name3-[5-(1,3-benzothiazol-2-yl)pentanoylamino]propanoic acid
PubChem CID119177074
Molecular FormulaC15H18N2O3S
Molecular Weight306.39 g/mol
Exact Mass306.10
IUPAC Name3-[5-(1,3-benzothiazol-2-yl)pentanoylamino]propanoic acid
SMILESO=C(O)CCNC(=O)CCCCc1nc2ccccc2s1
InChIInChI=1S/C15H18N2O3S/c18-13(16-10-9-15(19)20)7-3-4-8-14-17-11-5-1-2-6-12(11)21-14/h1-2,5-6H,3-4,7-10H2,(H,16,18)(H,19,20)
InChIKeyPETJIQMQOLYERJ-UHFFFAOYSA-N
XLogP2.60
TPSA79.29 Ų
H-Bond Donors2
H-Bond Acceptors4
Rotatable Bonds8
Heavy Atoms21
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500306.39
LogP ≤ 52.60
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}

Analyze 3-[5-(1,3-benzothiazol-2-yl)pentanoylamino]propanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3-[5-(1,3-benzothiazol-2-yl)pentanoylamino]propanoic acid?
The IUPAC name of 3-[5-(1,3-benzothiazol-2-yl)pentanoylamino]propanoic acid (CID 119177074) is 3-[5-(1,3-benzothiazol-2-yl)pentanoylamino]propanoic acid.
What is the SMILES notation for 3-[5-(1,3-benzothiazol-2-yl)pentanoylamino]propanoic acid?
The canonical SMILES for 3-[5-(1,3-benzothiazol-2-yl)pentanoylamino]propanoic acid is O=C(O)CCNC(=O)CCCCc1nc2ccccc2s1.
What is the InChIKey of 3-[5-(1,3-benzothiazol-2-yl)pentanoylamino]propanoic acid?
The InChIKey is PETJIQMQOLYERJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H18N2O3S/c18-13(16-10-9-15(19)20)7-3-4-8-14-17-11-5-1-2-6-12(11)21-14/h1-2,5-6H,3-4,7-10H2,(H,16,18)(H,19,20).
What are the key properties of 3-[5-(1,3-benzothiazol-2-yl)pentanoylamino]propanoic acid?
3-[5-(1,3-benzothiazol-2-yl)pentanoylamino]propanoic acid has a molecular weight of 306.39 g/mol, XLogP of 2.60, 8 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[5-(1,3-benzothiazol-2-yl)pentanoylamino]propanoic acid is sourced from PubChem (CID 119177074), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).