C15H18N2O3S — CID 119177074
3-[5-(1,3-benzothiazol-2-yl)pentanoylamino]propanoic acid (PubChem CID 119177074) has the molecular formula C15H18N2O3S and a molecular weight of 306.39 g/mol. Its IUPAC name is 3-[5-(1,3-benzothiazol-2-yl)pentanoylamino]propanoic acid.
| Compound Name | 3-[5-(1,3-benzothiazol-2-yl)pentanoylamino]propanoic acid |
|---|---|
| PubChem CID | 119177074 |
| Molecular Formula | C15H18N2O3S |
| Molecular Weight | 306.39 g/mol |
| Exact Mass | 306.10 |
| IUPAC Name | 3-[5-(1,3-benzothiazol-2-yl)pentanoylamino]propanoic acid |
| SMILES | O=C(O)CCNC(=O)CCCCc1nc2ccccc2s1 |
| InChI | InChI=1S/C15H18N2O3S/c18-13(16-10-9-15(19)20)7-3-4-8-14-17-11-5-1-2-6-12(11)21-14/h1-2,5-6H,3-4,7-10H2,(H,16,18)(H,19,20) |
| InChIKey | PETJIQMQOLYERJ-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 79.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.39 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|