C21H22N4OS — CID 30249316
N-[2-(1H-benzimidazol-2-yl)ethyl]-5-(1,3-benzothiazol-2-yl)pentanamide (PubChem CID 30249316) has the molecular formula C21H22N4OS and a molecular weight of 378.50 g/mol. Its IUPAC name is N-[2-(1H-benzimidazol-2-yl)ethyl]-5-(1,3-benzothiazol-2-yl)pentanamide.
| Compound Name | N-[2-(1H-benzimidazol-2-yl)ethyl]-5-(1,3-benzothiazol-2-yl)pentanamide |
|---|---|
| PubChem CID | 30249316 |
| Molecular Formula | C21H22N4OS |
| Molecular Weight | 378.50 g/mol |
| Exact Mass | 378.15 |
| IUPAC Name | N-[2-(1H-benzimidazol-2-yl)ethyl]-5-(1,3-benzothiazol-2-yl)pentanamide |
| SMILES | O=C(CCCCc1nc2ccccc2s1)NCCc1nc2ccccc2[nH]1 |
| InChI | InChI=1S/C21H22N4OS/c26-20(22-14-13-19-23-15-7-1-2-8-16(15)24-19)11-5-6-12-21-25-17-9-3-4-10-18(17)27-21/h1-4,7-10H,5-6,11-14H2,(H,22,26)(H,23,24) |
| InChIKey | YTEIBPKVPBSBNI-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.50 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|