C16H20N2O3S — CID 123617279
5-[4-(1,3-benzothiazol-2-yl)butylamino]-5-oxopentanoic acid (PubChem CID 123617279) has the molecular formula C16H20N2O3S and a molecular weight of 320.41 g/mol. Its IUPAC name is 5-[4-(1,3-benzothiazol-2-yl)butylamino]-5-oxopentanoic acid.
| Compound Name | 5-[4-(1,3-benzothiazol-2-yl)butylamino]-5-oxopentanoic acid |
|---|---|
| PubChem CID | 123617279 |
| Molecular Formula | C16H20N2O3S |
| Molecular Weight | 320.41 g/mol |
| Exact Mass | 320.12 |
| IUPAC Name | 5-[4-(1,3-benzothiazol-2-yl)butylamino]-5-oxopentanoic acid |
| SMILES | O=C(O)CCCC(=O)NCCCCc1nc2ccccc2s1 |
| InChI | InChI=1S/C16H20N2O3S/c19-14(8-5-10-16(20)21)17-11-4-3-9-15-18-12-6-1-2-7-13(12)22-15/h1-2,6-7H,3-5,8-11H2,(H,17,19)(H,20,21) |
| InChIKey | ZAANYYHYFGZTTP-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 79.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.41 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|