C17H22N2O3S — CID 9221053
methyl 6-[3-(1,3-benzothiazol-2-yl)propanoylamino]hexanoate (PubChem CID 9221053) has the molecular formula C17H22N2O3S and a molecular weight of 334.44 g/mol. Its IUPAC name is methyl 6-[3-(1,3-benzothiazol-2-yl)propanoylamino]hexanoate.
| Compound Name | methyl 6-[3-(1,3-benzothiazol-2-yl)propanoylamino]hexanoate |
|---|---|
| PubChem CID | 9221053 |
| Molecular Formula | C17H22N2O3S |
| Molecular Weight | 334.44 g/mol |
| Exact Mass | 334.14 |
| IUPAC Name | methyl 6-[3-(1,3-benzothiazol-2-yl)propanoylamino]hexanoate |
| SMILES | COC(=O)CCCCCNC(=O)CCc1nc2ccccc2s1 |
| InChI | InChI=1S/C17H22N2O3S/c1-22-17(21)9-3-2-6-12-18-15(20)10-11-16-19-13-7-4-5-8-14(13)23-16/h4-5,7-8H,2-3,6,9-12H2,1H3,(H,18,20) |
| InChIKey | BLYPXVXCGURFBY-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.44 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|