C17H23N3O2S2 — CID 9097395
methyl 6-[[1,3-benzothiazol-2-ylmethyl(methyl)carbamothioyl]amino]hexanoate (PubChem CID 9097395) has the molecular formula C17H23N3O2S2 and a molecular weight of 365.52 g/mol. Its IUPAC name is methyl 6-[[1,3-benzothiazol-2-ylmethyl(methyl)carbamothioyl]amino]hexanoate.
| Compound Name | methyl 6-[[1,3-benzothiazol-2-ylmethyl(methyl)carbamothioyl]amino]hexanoate |
|---|---|
| PubChem CID | 9097395 |
| Molecular Formula | C17H23N3O2S2 |
| Molecular Weight | 365.52 g/mol |
| Exact Mass | 365.12 |
| IUPAC Name | methyl 6-[[1,3-benzothiazol-2-ylmethyl(methyl)carbamothioyl]amino]hexanoate |
| SMILES | COC(=O)CCCCCNC(=S)N(C)Cc1nc2ccccc2s1 |
| InChI | InChI=1S/C17H23N3O2S2/c1-20(12-15-19-13-8-5-6-9-14(13)24-15)17(23)18-11-7-3-4-10-16(21)22-2/h5-6,8-9H,3-4,7,10-12H2,1-2H3,(H,18,23) |
| InChIKey | XBBIDYJNQIADQD-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.52 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|