methyl 3-[1,3-benzothiazol-2-ylmethyl(methyl)amino]propanoate

C13H16N2O2S — CID 60699740

IUPACmethyl 3-[1,3-benzothiazol-2-ylmethyl(methyl)amino]propanoate
SMILESCOC(=O)CCN(C)Cc1nc2ccccc2s1
InChIInChI=1S/C13H16N2O2S/c1-15(8-7-13(16)17-2)9-12-14-10-5-3-4-6-11(10)18-12/h3-6H,7-9H2,1-2H3
InChIKeyDTOBDNMBGPNOEU-UHFFFAOYSA-N
MW264.35 g/mol
LogP2.29
Rot. Bonds5

About methyl 3-[1,3-benzothiazol-2-ylmethyl(methyl)amino]propanoate

methyl 3-[1,3-benzothiazol-2-ylmethyl(methyl)amino]propanoate (PubChem CID 60699740) has the molecular formula C13H16N2O2S and a molecular weight of 264.35 g/mol. Its IUPAC name is methyl 3-[1,3-benzothiazol-2-ylmethyl(methyl)amino]propanoate.

Molecular Properties

Compound Namemethyl 3-[1,3-benzothiazol-2-ylmethyl(methyl)amino]propanoate
PubChem CID60699740
Molecular FormulaC13H16N2O2S
Molecular Weight264.35 g/mol
Exact Mass264.09
IUPAC Namemethyl 3-[1,3-benzothiazol-2-ylmethyl(methyl)amino]propanoate
SMILESCOC(=O)CCN(C)Cc1nc2ccccc2s1
InChIInChI=1S/C13H16N2O2S/c1-15(8-7-13(16)17-2)9-12-14-10-5-3-4-6-11(10)18-12/h3-6H,7-9H2,1-2H3
InChIKeyDTOBDNMBGPNOEU-UHFFFAOYSA-N
XLogP2.29
TPSA42.43 Ų
H-Bond Donors
H-Bond Acceptors5
Rotatable Bonds5
Heavy Atoms18
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500264.35
LogP ≤ 52.29
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 105

Analyze methyl 3-[1,3-benzothiazol-2-ylmethyl(methyl)amino]propanoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 3-[1,3-benzothiazol-2-ylmethyl(methyl)amino]propanoate?
The IUPAC name of methyl 3-[1,3-benzothiazol-2-ylmethyl(methyl)amino]propanoate (CID 60699740) is methyl 3-[1,3-benzothiazol-2-ylmethyl(methyl)amino]propanoate.
What is the SMILES notation for methyl 3-[1,3-benzothiazol-2-ylmethyl(methyl)amino]propanoate?
The canonical SMILES for methyl 3-[1,3-benzothiazol-2-ylmethyl(methyl)amino]propanoate is COC(=O)CCN(C)Cc1nc2ccccc2s1.
What is the InChIKey of methyl 3-[1,3-benzothiazol-2-ylmethyl(methyl)amino]propanoate?
The InChIKey is DTOBDNMBGPNOEU-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H16N2O2S/c1-15(8-7-13(16)17-2)9-12-14-10-5-3-4-6-11(10)18-12/h3-6H,7-9H2,1-2H3.
What are the key properties of methyl 3-[1,3-benzothiazol-2-ylmethyl(methyl)amino]propanoate?
methyl 3-[1,3-benzothiazol-2-ylmethyl(methyl)amino]propanoate has a molecular weight of 264.35 g/mol, XLogP of 2.29, 5 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 3-[1,3-benzothiazol-2-ylmethyl(methyl)amino]propanoate is sourced from PubChem (CID 60699740), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).