C12H13ClN2OS — CID 43346972
N-(1,3-benzothiazol-2-ylmethyl)-3-chloro-N-methylpropanamide (PubChem CID 43346972) has the molecular formula C12H13ClN2OS and a molecular weight of 268.77 g/mol. Its IUPAC name is N-(1,3-benzothiazol-2-ylmethyl)-3-chloro-N-methylpropanamide.
| Compound Name | N-(1,3-benzothiazol-2-ylmethyl)-3-chloro-N-methylpropanamide |
|---|---|
| PubChem CID | 43346972 |
| Molecular Formula | C12H13ClN2OS |
| Molecular Weight | 268.77 g/mol |
| Exact Mass | 268.04 |
| IUPAC Name | N-(1,3-benzothiazol-2-ylmethyl)-3-chloro-N-methylpropanamide |
| SMILES | CN(Cc1nc2ccccc2s1)C(=O)CCCl |
| InChI | InChI=1S/C12H13ClN2OS/c1-15(12(16)6-7-13)8-11-14-9-4-2-3-5-10(9)17-11/h2-5H,6-8H2,1H3 |
| InChIKey | JALDPKMXCVFIED-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.77 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|