C16H18N4O3S — CID 9393075
N-(1,3-benzothiazol-2-ylmethyl)-4-(2,5-dioxoimidazolidin-1-yl)-N-methylbutanamide (PubChem CID 9393075) has the molecular formula C16H18N4O3S and a molecular weight of 346.41 g/mol. Its IUPAC name is N-(1,3-benzothiazol-2-ylmethyl)-4-(2,5-dioxoimidazolidin-1-yl)-N-methylbutanamide.
| Compound Name | N-(1,3-benzothiazol-2-ylmethyl)-4-(2,5-dioxoimidazolidin-1-yl)-N-methylbutanamide |
|---|---|
| PubChem CID | 9393075 |
| Molecular Formula | C16H18N4O3S |
| Molecular Weight | 346.41 g/mol |
| Exact Mass | 346.11 |
| IUPAC Name | N-(1,3-benzothiazol-2-ylmethyl)-4-(2,5-dioxoimidazolidin-1-yl)-N-methylbutanamide |
| SMILES | CN(Cc1nc2ccccc2s1)C(=O)CCCN1C(=O)CNC1=O |
| InChI | InChI=1S/C16H18N4O3S/c1-19(10-13-18-11-5-2-3-6-12(11)24-13)14(21)7-4-8-20-15(22)9-17-16(20)23/h2-3,5-6H,4,7-10H2,1H3,(H,17,23) |
| InChIKey | GUAWYRYLVGQHRE-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 82.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.41 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|