C13H15NO2S — CID 18002644
methyl 5-(1,3-benzothiazol-2-yl)pentanoate (PubChem CID 18002644) has the molecular formula C13H15NO2S and a molecular weight of 249.34 g/mol. Its IUPAC name is methyl 5-(1,3-benzothiazol-2-yl)pentanoate.
| Compound Name | methyl 5-(1,3-benzothiazol-2-yl)pentanoate |
|---|---|
| PubChem CID | 18002644 |
| Molecular Formula | C13H15NO2S |
| Molecular Weight | 249.34 g/mol |
| Exact Mass | 249.08 |
| IUPAC Name | methyl 5-(1,3-benzothiazol-2-yl)pentanoate |
| SMILES | COC(=O)CCCCc1nc2ccccc2s1 |
| InChI | InChI=1S/C13H15NO2S/c1-16-13(15)9-5-4-8-12-14-10-6-2-3-7-11(10)17-12/h2-3,6-7H,4-5,8-9H2,1H3 |
| InChIKey | DGJUIJHJDRLZAU-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.34 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|