C19H17NO4S — CID 8961336
methyl 4-[4-(1,3-benzothiazol-2-yl)butanoyloxy]benzoate (PubChem CID 8961336) has the molecular formula C19H17NO4S and a molecular weight of 355.42 g/mol. Its IUPAC name is methyl 4-[4-(1,3-benzothiazol-2-yl)butanoyloxy]benzoate.
| Compound Name | methyl 4-[4-(1,3-benzothiazol-2-yl)butanoyloxy]benzoate |
|---|---|
| PubChem CID | 8961336 |
| Molecular Formula | C19H17NO4S |
| Molecular Weight | 355.42 g/mol |
| Exact Mass | 355.09 |
| IUPAC Name | methyl 4-[4-(1,3-benzothiazol-2-yl)butanoyloxy]benzoate |
| SMILES | COC(=O)c1ccc(OC(=O)CCCc2nc3ccccc3s2)cc1 |
| InChI | InChI=1S/C19H17NO4S/c1-23-19(22)13-9-11-14(12-10-13)24-18(21)8-4-7-17-20-15-5-2-3-6-16(15)25-17/h2-3,5-6,9-12H,4,7-8H2,1H3 |
| InChIKey | LGWOTLNCAWJNPJ-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 65.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.42 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|