C20H21NO3S — CID 55320432
2-(3-methylphenoxy)ethyl 4-(1,3-benzothiazol-2-yl)butanoate (PubChem CID 55320432) has the molecular formula C20H21NO3S and a molecular weight of 355.46 g/mol. Its IUPAC name is 2-(3-methylphenoxy)ethyl 4-(1,3-benzothiazol-2-yl)butanoate.
| Compound Name | 2-(3-methylphenoxy)ethyl 4-(1,3-benzothiazol-2-yl)butanoate |
|---|---|
| PubChem CID | 55320432 |
| Molecular Formula | C20H21NO3S |
| Molecular Weight | 355.46 g/mol |
| Exact Mass | 355.12 |
| IUPAC Name | 2-(3-methylphenoxy)ethyl 4-(1,3-benzothiazol-2-yl)butanoate |
| SMILES | Cc1cccc(OCCOC(=O)CCCc2nc3ccccc3s2)c1 |
| InChI | InChI=1S/C20H21NO3S/c1-15-6-4-7-16(14-15)23-12-13-24-20(22)11-5-10-19-21-17-8-2-3-9-18(17)25-19/h2-4,6-9,14H,5,10-13H2,1H3 |
| InChIKey | PXJBVIXQBJGIQQ-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 48.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.46 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|