C19H18N2O4S — CID 60554573
3-(1,3-benzothiazol-2-yl)propyl 3-(2-amino-2-oxoethoxy)benzoate (PubChem CID 60554573) has the molecular formula C19H18N2O4S and a molecular weight of 370.43 g/mol. Its IUPAC name is 3-(1,3-benzothiazol-2-yl)propyl 3-(2-amino-2-oxoethoxy)benzoate.
| Compound Name | 3-(1,3-benzothiazol-2-yl)propyl 3-(2-amino-2-oxoethoxy)benzoate |
|---|---|
| PubChem CID | 60554573 |
| Molecular Formula | C19H18N2O4S |
| Molecular Weight | 370.43 g/mol |
| Exact Mass | 370.10 |
| IUPAC Name | 3-(1,3-benzothiazol-2-yl)propyl 3-(2-amino-2-oxoethoxy)benzoate |
| SMILES | NC(=O)COc1cccc(C(=O)OCCCc2nc3ccccc3s2)c1 |
| InChI | InChI=1S/C19H18N2O4S/c20-17(22)12-25-14-6-3-5-13(11-14)19(23)24-10-4-9-18-21-15-7-1-2-8-16(15)26-18/h1-3,5-8,11H,4,9-10,12H2,(H2,20,22) |
| InChIKey | DBIPYINXLKLQBX-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 91.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.43 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|