C16H12ClNO3S — CID 7803684
1,3-benzothiazol-2-ylmethyl 2-(3-chlorophenoxy)acetate (PubChem CID 7803684) has the molecular formula C16H12ClNO3S and a molecular weight of 333.80 g/mol. Its IUPAC name is 1,3-benzothiazol-2-ylmethyl 2-(3-chlorophenoxy)acetate.
| Compound Name | 1,3-benzothiazol-2-ylmethyl 2-(3-chlorophenoxy)acetate |
|---|---|
| PubChem CID | 7803684 |
| Molecular Formula | C16H12ClNO3S |
| Molecular Weight | 333.80 g/mol |
| Exact Mass | 333.02 |
| IUPAC Name | 1,3-benzothiazol-2-ylmethyl 2-(3-chlorophenoxy)acetate |
| SMILES | O=C(COc1cccc(Cl)c1)OCc1nc2ccccc2s1 |
| InChI | InChI=1S/C16H12ClNO3S/c17-11-4-3-5-12(8-11)20-10-16(19)21-9-15-18-13-6-1-2-7-14(13)22-15/h1-8H,9-10H2 |
| InChIKey | YYWIRMKVAVIWSU-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 48.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.80 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |