C21H16N2O4S — CID 30805452
1,3-benzothiazol-2-ylmethyl 2-(4-pyridin-2-yloxyphenoxy)acetate (PubChem CID 30805452) has the molecular formula C21H16N2O4S and a molecular weight of 392.44 g/mol. Its IUPAC name is 1,3-benzothiazol-2-ylmethyl 2-(4-pyridin-2-yloxyphenoxy)acetate.
| Compound Name | 1,3-benzothiazol-2-ylmethyl 2-(4-pyridin-2-yloxyphenoxy)acetate |
|---|---|
| PubChem CID | 30805452 |
| Molecular Formula | C21H16N2O4S |
| Molecular Weight | 392.44 g/mol |
| Exact Mass | 392.08 |
| IUPAC Name | 1,3-benzothiazol-2-ylmethyl 2-(4-pyridin-2-yloxyphenoxy)acetate |
| SMILES | O=C(COc1ccc(Oc2ccccn2)cc1)OCc1nc2ccccc2s1 |
| InChI | InChI=1S/C21H16N2O4S/c24-21(26-13-20-23-17-5-1-2-6-18(17)28-20)14-25-15-8-10-16(11-9-15)27-19-7-3-4-12-22-19/h1-12H,13-14H2 |
| InChIKey | MFDQGUAJQIWQOE-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 70.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.44 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |