2-(1,3-benzothiazol-2-yl)ethyl 2-(4-propanoylphenoxy)acetate

C20H19NO4S — CID 78822419

IUPAC2-(1,3-benzothiazol-2-yl)ethyl 2-(4-propanoylphenoxy)acetate
SMILESCCC(=O)c1ccc(OCC(=O)OCCc2nc3ccccc3s2)cc1
InChIInChI=1S/C20H19NO4S/c1-2-17(22)14-7-9-15(10-8-14)25-13-20(23)24-12-11-19-21-16-5-3-4-6-18(16)26-19/h3-10H,2,11-13H2,1H3
InChIKeyUCNHPEADTOORGO-UHFFFAOYSA-N
MW369.44 g/mol
LogP4.05
Rot. Bonds8

About 2-(1,3-benzothiazol-2-yl)ethyl 2-(4-propanoylphenoxy)acetate

2-(1,3-benzothiazol-2-yl)ethyl 2-(4-propanoylphenoxy)acetate (PubChem CID 78822419) has the molecular formula C20H19NO4S and a molecular weight of 369.44 g/mol. Its IUPAC name is 2-(1,3-benzothiazol-2-yl)ethyl 2-(4-propanoylphenoxy)acetate.

Molecular Properties

Compound Name2-(1,3-benzothiazol-2-yl)ethyl 2-(4-propanoylphenoxy)acetate
PubChem CID78822419
Molecular FormulaC20H19NO4S
Molecular Weight369.44 g/mol
Exact Mass369.10
IUPAC Name2-(1,3-benzothiazol-2-yl)ethyl 2-(4-propanoylphenoxy)acetate
SMILESCCC(=O)c1ccc(OCC(=O)OCCc2nc3ccccc3s2)cc1
InChIInChI=1S/C20H19NO4S/c1-2-17(22)14-7-9-15(10-8-14)25-13-20(23)24-12-11-19-21-16-5-3-4-6-18(16)26-19/h3-10H,2,11-13H2,1H3
InChIKeyUCNHPEADTOORGO-UHFFFAOYSA-N
XLogP4.05
TPSA65.49 Ų
H-Bond Donors
H-Bond Acceptors6
Rotatable Bonds8
Heavy Atoms26
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500369.44
LogP ≤ 54.05
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 106

Analyze 2-(1,3-benzothiazol-2-yl)ethyl 2-(4-propanoylphenoxy)acetate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-(1,3-benzothiazol-2-yl)ethyl 2-(4-propanoylphenoxy)acetate?
The IUPAC name of 2-(1,3-benzothiazol-2-yl)ethyl 2-(4-propanoylphenoxy)acetate (CID 78822419) is 2-(1,3-benzothiazol-2-yl)ethyl 2-(4-propanoylphenoxy)acetate.
What is the SMILES notation for 2-(1,3-benzothiazol-2-yl)ethyl 2-(4-propanoylphenoxy)acetate?
The canonical SMILES for 2-(1,3-benzothiazol-2-yl)ethyl 2-(4-propanoylphenoxy)acetate is CCC(=O)c1ccc(OCC(=O)OCCc2nc3ccccc3s2)cc1.
What is the InChIKey of 2-(1,3-benzothiazol-2-yl)ethyl 2-(4-propanoylphenoxy)acetate?
The InChIKey is UCNHPEADTOORGO-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H19NO4S/c1-2-17(22)14-7-9-15(10-8-14)25-13-20(23)24-12-11-19-21-16-5-3-4-6-18(16)26-19/h3-10H,2,11-13H2,1H3.
What are the key properties of 2-(1,3-benzothiazol-2-yl)ethyl 2-(4-propanoylphenoxy)acetate?
2-(1,3-benzothiazol-2-yl)ethyl 2-(4-propanoylphenoxy)acetate has a molecular weight of 369.44 g/mol, XLogP of 4.05, 8 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(1,3-benzothiazol-2-yl)ethyl 2-(4-propanoylphenoxy)acetate is sourced from PubChem (CID 78822419), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).