C20H19NO4S — CID 78822419
2-(1,3-benzothiazol-2-yl)ethyl 2-(4-propanoylphenoxy)acetate (PubChem CID 78822419) has the molecular formula C20H19NO4S and a molecular weight of 369.44 g/mol. Its IUPAC name is 2-(1,3-benzothiazol-2-yl)ethyl 2-(4-propanoylphenoxy)acetate.
| Compound Name | 2-(1,3-benzothiazol-2-yl)ethyl 2-(4-propanoylphenoxy)acetate |
|---|---|
| PubChem CID | 78822419 |
| Molecular Formula | C20H19NO4S |
| Molecular Weight | 369.44 g/mol |
| Exact Mass | 369.10 |
| IUPAC Name | 2-(1,3-benzothiazol-2-yl)ethyl 2-(4-propanoylphenoxy)acetate |
| SMILES | CCC(=O)c1ccc(OCC(=O)OCCc2nc3ccccc3s2)cc1 |
| InChI | InChI=1S/C20H19NO4S/c1-2-17(22)14-7-9-15(10-8-14)25-13-20(23)24-12-11-19-21-16-5-3-4-6-18(16)26-19/h3-10H,2,11-13H2,1H3 |
| InChIKey | UCNHPEADTOORGO-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 65.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.44 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |