C18H16FNO2S — CID 78822451
2-(1,3-benzothiazol-2-yl)ethyl 3-(4-fluorophenyl)propanoate (PubChem CID 78822451) has the molecular formula C18H16FNO2S and a molecular weight of 329.40 g/mol. Its IUPAC name is 2-(1,3-benzothiazol-2-yl)ethyl 3-(4-fluorophenyl)propanoate.
| Compound Name | 2-(1,3-benzothiazol-2-yl)ethyl 3-(4-fluorophenyl)propanoate |
|---|---|
| PubChem CID | 78822451 |
| Molecular Formula | C18H16FNO2S |
| Molecular Weight | 329.40 g/mol |
| Exact Mass | 329.09 |
| IUPAC Name | 2-(1,3-benzothiazol-2-yl)ethyl 3-(4-fluorophenyl)propanoate |
| SMILES | O=C(CCc1ccc(F)cc1)OCCc1nc2ccccc2s1 |
| InChI | InChI=1S/C18H16FNO2S/c19-14-8-5-13(6-9-14)7-10-18(21)22-12-11-17-20-15-3-1-2-4-16(15)23-17/h1-6,8-9H,7,10-12H2 |
| InChIKey | LECXYPOLPUTNMW-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.40 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |