C11H11NO3S — CID 13285733
2-[2-(1,3-benzothiazol-2-yl)ethoxy]acetic acid (PubChem CID 13285733) has the molecular formula C11H11NO3S and a molecular weight of 237.28 g/mol. Its IUPAC name is 2-[2-(1,3-benzothiazol-2-yl)ethoxy]acetic acid.
| Compound Name | 2-[2-(1,3-benzothiazol-2-yl)ethoxy]acetic acid |
|---|---|
| PubChem CID | 13285733 |
| Molecular Formula | C11H11NO3S |
| Molecular Weight | 237.28 g/mol |
| Exact Mass | 237.05 |
| IUPAC Name | 2-[2-(1,3-benzothiazol-2-yl)ethoxy]acetic acid |
| SMILES | O=C(O)COCCc1nc2ccccc2s1 |
| InChI | InChI=1S/C11H11NO3S/c13-11(14)7-15-6-5-10-12-8-3-1-2-4-9(8)16-10/h1-4H,5-7H2,(H,13,14) |
| InChIKey | VJZKYIWSWZMPJZ-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 59.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.28 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|