C11H11NO2S — CID 103451335
1-(1,3-benzothiazol-2-yl)-3-hydroxybutan-2-one (PubChem CID 103451335) has the molecular formula C11H11NO2S and a molecular weight of 221.28 g/mol. Its IUPAC name is 1-(1,3-benzothiazol-2-yl)-3-hydroxybutan-2-one.
| Compound Name | 1-(1,3-benzothiazol-2-yl)-3-hydroxybutan-2-one |
|---|---|
| PubChem CID | 103451335 |
| Molecular Formula | C11H11NO2S |
| Molecular Weight | 221.28 g/mol |
| Exact Mass | 221.05 |
| IUPAC Name | 1-(1,3-benzothiazol-2-yl)-3-hydroxybutan-2-one |
| SMILES | CC(O)C(=O)Cc1nc2ccccc2s1 |
| InChI | InChI=1S/C11H11NO2S/c1-7(13)9(14)6-11-12-8-4-2-3-5-10(8)15-11/h2-5,7,13H,6H2,1H3 |
| InChIKey | NBFRUXFBXSKDMR-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 50.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.28 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |