C11H9F2NOS — CID 147790284
1-(1,3-benzothiazol-2-yl)-4,4-difluorobutan-2-one (PubChem CID 147790284) has the molecular formula C11H9F2NOS and a molecular weight of 241.26 g/mol. Its IUPAC name is 1-(1,3-benzothiazol-2-yl)-4,4-difluorobutan-2-one.
| Compound Name | 1-(1,3-benzothiazol-2-yl)-4,4-difluorobutan-2-one |
|---|---|
| PubChem CID | 147790284 |
| Molecular Formula | C11H9F2NOS |
| Molecular Weight | 241.26 g/mol |
| Exact Mass | 241.04 |
| IUPAC Name | 1-(1,3-benzothiazol-2-yl)-4,4-difluorobutan-2-one |
| SMILES | O=C(Cc1nc2ccccc2s1)CC(F)F |
| InChI | InChI=1S/C11H9F2NOS/c12-10(13)5-7(15)6-11-14-8-3-1-2-4-9(8)16-11/h1-4,10H,5-6H2 |
| InChIKey | HJMQDDSABUMJBY-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 29.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.26 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |