C16H11F2NOS — CID 115787180
1-(1,3-benzothiazol-2-yl)-3-(2,6-difluorophenyl)propan-2-one (PubChem CID 115787180) has the molecular formula C16H11F2NOS and a molecular weight of 303.33 g/mol. Its IUPAC name is 1-(1,3-benzothiazol-2-yl)-3-(2,6-difluorophenyl)propan-2-one.
| Compound Name | 1-(1,3-benzothiazol-2-yl)-3-(2,6-difluorophenyl)propan-2-one |
|---|---|
| PubChem CID | 115787180 |
| Molecular Formula | C16H11F2NOS |
| Molecular Weight | 303.33 g/mol |
| Exact Mass | 303.05 |
| IUPAC Name | 1-(1,3-benzothiazol-2-yl)-3-(2,6-difluorophenyl)propan-2-one |
| SMILES | O=C(Cc1nc2ccccc2s1)Cc1c(F)cccc1F |
| InChI | InChI=1S/C16H11F2NOS/c17-12-4-3-5-13(18)11(12)8-10(20)9-16-19-14-6-1-2-7-15(14)21-16/h1-7H,8-9H2 |
| InChIKey | CILYMXNRLPUDPW-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 29.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.33 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |