C13H12KNO3S — CID 58580432
potassium 6-(1,3-benzothiazol-2-yl)-5-oxohexanoate (PubChem CID 58580432) has the molecular formula C13H12KNO3S and a molecular weight of 301.41 g/mol. Its IUPAC name is potassium 6-(1,3-benzothiazol-2-yl)-5-oxohexanoate.
| Compound Name | potassium 6-(1,3-benzothiazol-2-yl)-5-oxohexanoate |
|---|---|
| PubChem CID | 58580432 |
| Molecular Formula | C13H12KNO3S |
| Molecular Weight | 301.41 g/mol |
| Exact Mass | 301.02 |
| IUPAC Name | potassium 6-(1,3-benzothiazol-2-yl)-5-oxohexanoate |
| SMILES | O=C([O-])CCCC(=O)Cc1nc2ccccc2s1.[K+] |
| InChI | InChI=1S/C13H13NO3S.K/c15-9(4-3-7-13(16)17)8-12-14-10-5-1-2-6-11(10)18-12;/h1-2,5-6H,3-4,7-8H2,(H,16,17);/q;+1/p-1 |
| InChIKey | CTLFMQIICULOHC-UHFFFAOYSA-M |
| XLogP | -1.67 |
| TPSA | 70.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.41 |
| LogP ≤ 5 | -1.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |