C9H8NS- — CID 123878265
2-ethyl-1,3-benzothiazole (PubChem CID 123878265) has the molecular formula C9H8NS- and a molecular weight of 162.24 g/mol. Its IUPAC name is 2-ethyl-1,3-benzothiazole.
| Compound Name | 2-ethyl-1,3-benzothiazole |
|---|---|
| PubChem CID | 123878265 |
| Molecular Formula | C9H8NS- |
| Molecular Weight | 162.24 g/mol |
| Exact Mass | 162.04 |
| IUPAC Name | 2-ethyl-1,3-benzothiazole |
| SMILES | [CH2-]Cc1nc2ccccc2s1 |
| InChI | InChI=1S/C9H8NS/c1-2-9-10-7-5-3-4-6-8(7)11-9/h3-6H,1-2H2/q-1 |
| InChIKey | QVPMOCSRTRMIFR-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 162.24 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|