C10H10LiNS — CID 134890790
lithium 2-propyl-1,3-benzothiazole (PubChem CID 134890790) has the molecular formula C10H10LiNS and a molecular weight of 183.21 g/mol. Its IUPAC name is lithium 2-propyl-1,3-benzothiazole.
| Compound Name | lithium 2-propyl-1,3-benzothiazole |
|---|---|
| PubChem CID | 134890790 |
| Molecular Formula | C10H10LiNS |
| Molecular Weight | 183.21 g/mol |
| Exact Mass | 183.07 |
| IUPAC Name | lithium 2-propyl-1,3-benzothiazole |
| SMILES | C[CH-]Cc1nc2ccccc2s1.[Li+] |
| InChI | InChI=1S/C10H10NS.Li/c1-2-5-10-11-8-6-3-4-7-9(8)12-10;/h2-4,6-7H,5H2,1H3;/q-1;+1 |
| InChIKey | YJOAWMPELXWLFS-UHFFFAOYSA-N |
| XLogP | 0.07 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.21 |
| LogP ≤ 5 | 0.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|