C12H16NO2PS — CID 118336965
1,3-benzothiazol-2-ylmethyl(diethoxy)phosphane (PubChem CID 118336965) has the molecular formula C12H16NO2PS and a molecular weight of 269.31 g/mol. Its IUPAC name is 1,3-benzothiazol-2-ylmethyl(diethoxy)phosphane.
| Compound Name | 1,3-benzothiazol-2-ylmethyl(diethoxy)phosphane |
|---|---|
| PubChem CID | 118336965 |
| Molecular Formula | C12H16NO2PS |
| Molecular Weight | 269.31 g/mol |
| Exact Mass | 269.06 |
| IUPAC Name | 1,3-benzothiazol-2-ylmethyl(diethoxy)phosphane |
| SMILES | CCOP(Cc1nc2ccccc2s1)OCC |
| InChI | InChI=1S/C12H16NO2PS/c1-3-14-16(15-4-2)9-12-13-10-7-5-6-8-11(10)17-12/h5-8H,3-4,9H2,1-2H3 |
| InChIKey | MHWSHONXOCOPKU-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 31.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.31 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|