C13H17NO2S — CID 113493284
1-(1,3-benzothiazol-2-yl)-3-ethoxy-2-methylpropan-2-ol (PubChem CID 113493284) has the molecular formula C13H17NO2S and a molecular weight of 251.35 g/mol. Its IUPAC name is 1-(1,3-benzothiazol-2-yl)-3-ethoxy-2-methylpropan-2-ol.
| Compound Name | 1-(1,3-benzothiazol-2-yl)-3-ethoxy-2-methylpropan-2-ol |
|---|---|
| PubChem CID | 113493284 |
| Molecular Formula | C13H17NO2S |
| Molecular Weight | 251.35 g/mol |
| Exact Mass | 251.10 |
| IUPAC Name | 1-(1,3-benzothiazol-2-yl)-3-ethoxy-2-methylpropan-2-ol |
| SMILES | CCOCC(C)(O)Cc1nc2ccccc2s1 |
| InChI | InChI=1S/C13H17NO2S/c1-3-16-9-13(2,15)8-12-14-10-6-4-5-7-11(10)17-12/h4-7,15H,3,8-9H2,1-2H3 |
| InChIKey | WYEKNCSZXRRPKA-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 42.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.35 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |