C14H19NO3S — CID 79818770
3-(1,3-benzothiazol-2-yl)-1,1-diethoxypropan-2-ol (PubChem CID 79818770) has the molecular formula C14H19NO3S and a molecular weight of 281.38 g/mol. Its IUPAC name is 3-(1,3-benzothiazol-2-yl)-1,1-diethoxypropan-2-ol.
| Compound Name | 3-(1,3-benzothiazol-2-yl)-1,1-diethoxypropan-2-ol |
|---|---|
| PubChem CID | 79818770 |
| Molecular Formula | C14H19NO3S |
| Molecular Weight | 281.38 g/mol |
| Exact Mass | 281.11 |
| IUPAC Name | 3-(1,3-benzothiazol-2-yl)-1,1-diethoxypropan-2-ol |
| SMILES | CCOC(OCC)C(O)Cc1nc2ccccc2s1 |
| InChI | InChI=1S/C14H19NO3S/c1-3-17-14(18-4-2)11(16)9-13-15-10-7-5-6-8-12(10)19-13/h5-8,11,14,16H,3-4,9H2,1-2H3 |
| InChIKey | GMBLSLPGHRGSBR-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 51.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.38 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|