C18H19NOS — CID 115823008
1-(1,3-benzothiazol-2-yl)-3-phenylpentan-2-ol (PubChem CID 115823008) has the molecular formula C18H19NOS and a molecular weight of 297.42 g/mol. Its IUPAC name is 1-(1,3-benzothiazol-2-yl)-3-phenylpentan-2-ol.
| Compound Name | 1-(1,3-benzothiazol-2-yl)-3-phenylpentan-2-ol |
|---|---|
| PubChem CID | 115823008 |
| Molecular Formula | C18H19NOS |
| Molecular Weight | 297.42 g/mol |
| Exact Mass | 297.12 |
| IUPAC Name | 1-(1,3-benzothiazol-2-yl)-3-phenylpentan-2-ol |
| SMILES | CCC(c1ccccc1)C(O)Cc1nc2ccccc2s1 |
| InChI | InChI=1S/C18H19NOS/c1-2-14(13-8-4-3-5-9-13)16(20)12-18-19-15-10-6-7-11-17(15)21-18/h3-11,14,16,20H,2,12H2,1H3 |
| InChIKey | OMXWSKVVDBIVIY-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.42 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |