C17H17NS — CID 56999152
2-(2-phenylbutyl)-1,3-benzothiazole (PubChem CID 56999152) has the molecular formula C17H17NS and a molecular weight of 267.40 g/mol. Its IUPAC name is 2-(2-phenylbutyl)-1,3-benzothiazole.
| Compound Name | 2-(2-phenylbutyl)-1,3-benzothiazole |
|---|---|
| PubChem CID | 56999152 |
| Molecular Formula | C17H17NS |
| Molecular Weight | 267.40 g/mol |
| Exact Mass | 267.11 |
| IUPAC Name | 2-(2-phenylbutyl)-1,3-benzothiazole |
| SMILES | CCC(Cc1nc2ccccc2s1)c1ccccc1 |
| InChI | InChI=1S/C17H17NS/c1-2-13(14-8-4-3-5-9-14)12-17-18-15-10-6-7-11-16(15)19-17/h3-11,13H,2,12H2,1H3 |
| InChIKey | QSEUHUTYMNFBQZ-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.40 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |