C12H14ClNS — CID 63203228
2-(2-chloropentyl)-1,3-benzothiazole (PubChem CID 63203228) has the molecular formula C12H14ClNS and a molecular weight of 239.77 g/mol. Its IUPAC name is 2-(2-chloropentyl)-1,3-benzothiazole.
| Compound Name | 2-(2-chloropentyl)-1,3-benzothiazole |
|---|---|
| PubChem CID | 63203228 |
| Molecular Formula | C12H14ClNS |
| Molecular Weight | 239.77 g/mol |
| Exact Mass | 239.05 |
| IUPAC Name | 2-(2-chloropentyl)-1,3-benzothiazole |
| SMILES | CCCC(Cl)Cc1nc2ccccc2s1 |
| InChI | InChI=1S/C12H14ClNS/c1-2-5-9(13)8-12-14-10-6-3-4-7-11(10)15-12/h3-4,6-7,9H,2,5,8H2,1H3 |
| InChIKey | GRYLWDKYSUJPIE-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.77 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|