C12H16N2S — CID 43118668
1-(1,3-benzothiazol-2-yl)pentan-2-amine (PubChem CID 43118668) has the molecular formula C12H16N2S and a molecular weight of 220.34 g/mol. Its IUPAC name is 1-(1,3-benzothiazol-2-yl)pentan-2-amine.
| Compound Name | 1-(1,3-benzothiazol-2-yl)pentan-2-amine |
|---|---|
| PubChem CID | 43118668 |
| Molecular Formula | C12H16N2S |
| Molecular Weight | 220.34 g/mol |
| Exact Mass | 220.10 |
| IUPAC Name | 1-(1,3-benzothiazol-2-yl)pentan-2-amine |
| SMILES | CCCC(N)Cc1nc2ccccc2s1 |
| InChI | InChI=1S/C12H16N2S/c1-2-5-9(13)8-12-14-10-6-3-4-7-11(10)15-12/h3-4,6-7,9H,2,5,8,13H2,1H3 |
| InChIKey | NFSCZLLEOUDZBJ-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.34 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |