C11H14N2OS — CID 63197747
1-(1,3-benzothiazol-2-yl)-3-methoxypropan-2-amine (PubChem CID 63197747) has the molecular formula C11H14N2OS and a molecular weight of 222.31 g/mol. Its IUPAC name is 1-(1,3-benzothiazol-2-yl)-3-methoxypropan-2-amine.
| Compound Name | 1-(1,3-benzothiazol-2-yl)-3-methoxypropan-2-amine |
|---|---|
| PubChem CID | 63197747 |
| Molecular Formula | C11H14N2OS |
| Molecular Weight | 222.31 g/mol |
| Exact Mass | 222.08 |
| IUPAC Name | 1-(1,3-benzothiazol-2-yl)-3-methoxypropan-2-amine |
| SMILES | COCC(N)Cc1nc2ccccc2s1 |
| InChI | InChI=1S/C11H14N2OS/c1-14-7-8(12)6-11-13-9-4-2-3-5-10(9)15-11/h2-5,8H,6-7,12H2,1H3 |
| InChIKey | OFRQPKLFZMXVIV-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 48.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.31 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |